About [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate
[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate (PubChem CID 46856585) has the molecular formula C18H13FN4O3
and a molecular weight of 352.33 g/mol. Its IUPAC name is [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate.
Molecular Properties
| Compound Name | [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate |
| PubChem CID | 46856585 |
| Molecular Formula | C18H13FN4O3 |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate |
| SMILES | Cn1nc(C(=O)OCc2nc(-c3cccc(F)c3)no2)c2ccccc21 |
| InChI | InChI=1S/C18H13FN4O3/c1-23-14-8-3-2-7-13(14)16(21-23)18(24)25-10-15-20-17(22-26-15)11-5-4-6-12(19)9-11/h2-9H,10H2,1H3 |
| InChIKey | CREZVUNMLXERAN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate?
The IUPAC name of [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate (CID 46856585) is [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate.
What is the SMILES notation for [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate?
The canonical SMILES for [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate is Cn1nc(C(=O)OCc2nc(-c3cccc(F)c3)no2)c2ccccc21.
What is the InChIKey of [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate?
The InChIKey is CREZVUNMLXERAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FN4O3/c1-23-14-8-3-2-7-13(14)16(21-23)18(24)25-10-15-20-17(22-26-15)11-5-4-6-12(19)9-11/h2-9H,10H2,1H3.
What are the key properties of [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate?
[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate has a molecular weight of 352.33 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 1-methylindazole-3-carboxylate is sourced from PubChem (CID 46856585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).