About [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate
[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate (PubChem CID 46856608) has the molecular formula C16H9BrClFN2O3
and a molecular weight of 411.61 g/mol. Its IUPAC name is [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate.
Molecular Properties
| Compound Name | [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate |
| PubChem CID | 46856608 |
| Molecular Formula | C16H9BrClFN2O3 |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate |
| SMILES | O=C(OCc1nc(-c2ccc(Br)cc2)no1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H9BrClFN2O3/c17-10-3-1-9(2-4-10)15-20-14(24-21-15)8-23-16(22)12-6-5-11(19)7-13(12)18/h1-7H,8H2 |
| InChIKey | BUXKHVFBGAELFB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate?
The IUPAC name of [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate (CID 46856608) is [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate.
What is the SMILES notation for [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate?
The canonical SMILES for [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate is O=C(OCc1nc(-c2ccc(Br)cc2)no1)c1ccc(F)cc1Cl.
What is the InChIKey of [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate?
The InChIKey is BUXKHVFBGAELFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9BrClFN2O3/c17-10-3-1-9(2-4-10)15-20-14(24-21-15)8-23-16(22)12-6-5-11(19)7-13(12)18/h1-7H,8H2.
What are the key properties of [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate?
[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate has a molecular weight of 411.61 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-chloro-4-fluorobenzoate is sourced from PubChem (CID 46856608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).