C18H27N3OS — CID 4685800
N-(4-propan-2-ylphenyl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)acetamide (PubChem CID 4685800) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)acetamide.
| Compound Name | N-(4-propan-2-ylphenyl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)acetamide |
|---|---|
| PubChem CID | 4685800 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)CN2C(=S)NC(C)(C)CC2C)cc1 |
| InChI | InChI=1S/C18H27N3OS/c1-12(2)14-6-8-15(9-7-14)19-16(22)11-21-13(3)10-18(4,5)20-17(21)23/h6-9,12-13H,10-11H2,1-5H3,(H,19,22)(H,20,23) |
| InChIKey | JYXKYRCFQFNEGR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|