C26H22N4O4 — CID 46859219
(7Z)-2-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole (PubChem CID 46859219) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is (7Z)-2-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole.
| Compound Name | (7Z)-2-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole |
|---|---|
| PubChem CID | 46859219 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (7Z)-2-(4-nitrophenyl)-7-[(4-nitrophenyl)methylidene]-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole |
| SMILES | O=[N+]([O-])c1ccc(/C=C2/CCCC3C2=NN(c2ccc([N+](=O)[O-])cc2)C3c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N4O4/c31-29(32)22-11-9-18(10-12-22)17-20-7-4-8-24-25(20)27-28(26(24)19-5-2-1-3-6-19)21-13-15-23(16-14-21)30(33)34/h1-3,5-6,9-17,24,26H,4,7-8H2/b20-17- |
| InChIKey | DJSUJOQACAFWHA-JZJYNLBNSA-N |
| XLogP | 6.30 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|