C19H19NO5 — CID 46860693
[2-(2-ethoxyanilino)-2-oxoethyl] 3-acetylbenzoate (PubChem CID 46860693) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] 3-acetylbenzoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] 3-acetylbenzoate |
|---|---|
| PubChem CID | 46860693 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] 3-acetylbenzoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C19H19NO5/c1-3-24-17-10-5-4-9-16(17)20-18(22)12-25-19(23)15-8-6-7-14(11-15)13(2)21/h4-11H,3,12H2,1-2H3,(H,20,22) |
| InChIKey | PLIJHWIWGGBMBX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |