C11H16F7NO — CID 4686073
2,2,3,3,4,4,4-heptafluoro-N-heptan-2-ylbutanamide (PubChem CID 4686073) has the molecular formula C11H16F7NO and a molecular weight of 311.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-heptan-2-ylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-heptan-2-ylbutanamide |
|---|---|
| PubChem CID | 4686073 |
| Molecular Formula | C11H16F7NO |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-heptan-2-ylbutanamide |
| SMILES | CCCCCC(C)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F7NO/c1-3-4-5-6-7(2)19-8(20)9(12,13)10(14,15)11(16,17)18/h7H,3-6H2,1-2H3,(H,19,20) |
| InChIKey | PFQQFKZQVVSAND-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|