C16H15NO4 — CID 46861776
(E)-3-(3,4-dihydroxyphenyl)-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 46861776) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46861776 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H15NO4/c1-21-13-6-4-12(5-7-13)17-16(20)9-3-11-2-8-14(18)15(19)10-11/h2-10,18-19H,1H3,(H,17,20)/b9-3+ |
| InChIKey | MGXQKQSEWXXTPE-YCRREMRBSA-N |
| XLogP | 2.76 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|