About 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine
5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 46861824) has the molecular formula C19H17N5
and a molecular weight of 315.38 g/mol. Its IUPAC name is 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine |
| PubChem CID | 46861824 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(CN2c3ccccc3C=Cc3ccccc32)c(N)n1 |
| InChI | InChI=1S/C19H17N5/c20-18-15(11-22-19(21)23-18)12-24-16-7-3-1-5-13(16)9-10-14-6-2-4-8-17(14)24/h1-11H,12H2,(H4,20,21,22,23) |
| InChIKey | UPRXQCYUCJQSIA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine?
The IUPAC name of 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine (CID 46861824) is 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine is Nc1ncc(CN2c3ccccc3C=Cc3ccccc32)c(N)n1.
What is the InChIKey of 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine?
The InChIKey is UPRXQCYUCJQSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5/c20-18-15(11-22-19(21)23-18)12-24-16-7-3-1-5-13(16)9-10-14-6-2-4-8-17(14)24/h1-11H,12H2,(H4,20,21,22,23).
What are the key properties of 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine?
5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine has a molecular weight of 315.38 g/mol, XLogP of 3.46, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzo[b][1]benzazepin-11-ylmethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 46861824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).