About N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide
N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide (PubChem CID 46861872) has the molecular formula C19H23N7
and a molecular weight of 349.44 g/mol. Its IUPAC name is N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide.
Molecular Properties
| Compound Name | N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide |
| PubChem CID | 46861872 |
| Molecular Formula | C19H23N7 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide |
| SMILES | N#CN/C(=N\CCCN1CCN(c2ccccn2)CC1)c1ccncc1 |
| InChI | InChI=1S/C19H23N7/c20-16-24-19(17-5-9-21-10-6-17)23-8-3-11-25-12-14-26(15-13-25)18-4-1-2-7-22-18/h1-2,4-7,9-10H,3,8,11-15H2,(H,23,24) |
| InChIKey | JPCJGSJYXPPMAF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide?
The IUPAC name of N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide (CID 46861872) is N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide.
What is the SMILES notation for N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide?
The canonical SMILES for N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide is N#CN/C(=N\CCCN1CCN(c2ccccn2)CC1)c1ccncc1.
What is the InChIKey of N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide?
The InChIKey is JPCJGSJYXPPMAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N7/c20-16-24-19(17-5-9-21-10-6-17)23-8-3-11-25-12-14-26(15-13-25)18-4-1-2-7-22-18/h1-2,4-7,9-10H,3,8,11-15H2,(H,23,24).
What are the key properties of N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide?
N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide has a molecular weight of 349.44 g/mol, XLogP of 1.51, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-N'-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]pyridine-4-carboximidamide is sourced from PubChem (CID 46861872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).