C11H19N3O6 — CID 46862073
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(1-hydroxypropyl)triazol-1-yl]oxane-3,4,5-triol (PubChem CID 46862073) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(1-hydroxypropyl)triazol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(1-hydroxypropyl)triazol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46862073 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(1-hydroxypropyl)triazol-1-yl]oxane-3,4,5-triol |
| SMILES | CCC(O)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C11H19N3O6/c1-2-6(16)5-3-14(13-12-5)11-10(19)9(18)8(17)7(4-15)20-11/h3,6-11,15-19H,2,4H2,1H3/t6?,7-,8-,9+,10-,11-/m1/s1 |
| InChIKey | UIBGLYOQXHZCQZ-RSDOQXBQSA-N |
| XLogP | -2.31 |
| TPSA | 141.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |