C28H32N4O2 — CID 46862244
2-[3-[2-[4-[(7-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)amino]anilino]ethyl]-1H-indol-7-yl]propan-2-ol (PubChem CID 46862244) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[3-[2-[4-[(7-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)amino]anilino]ethyl]-1H-indol-7-yl]propan-2-ol.
| Compound Name | 2-[3-[2-[4-[(7-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)amino]anilino]ethyl]-1H-indol-7-yl]propan-2-ol |
|---|---|
| PubChem CID | 46862244 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 2-[3-[2-[4-[(7-methoxy-6,7-dihydro-5H-cyclopenta[b]pyridin-4-yl)amino]anilino]ethyl]-1H-indol-7-yl]propan-2-ol |
| SMILES | COC1CCc2c(Nc3ccc(NCCc4c[nH]c5c(C(C)(C)O)cccc45)cc3)ccnc21 |
| InChI | InChI=1S/C28H32N4O2/c1-28(2,33)23-6-4-5-21-18(17-31-26(21)23)13-15-29-19-7-9-20(10-8-19)32-24-14-16-30-27-22(24)11-12-25(27)34-3/h4-10,14,16-17,25,29,31,33H,11-13,15H2,1-3H3,(H,30,32) |
| InChIKey | AVAHNZJFZCONBH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|