About 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole
1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole (PubChem CID 46862313) has the molecular formula C30H34N4Se2
and a molecular weight of 608.55 g/mol. Its IUPAC name is 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole.
Molecular Properties
| Compound Name | 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole |
| PubChem CID | 46862313 |
| Molecular Formula | C30H34N4Se2 |
| Molecular Weight | 608.55 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole |
| SMILES | c1ccc([Se]CCCCCn2cnc3cc4ncn(CCCCC[Se]c5ccccc5)c4cc32)cc1 |
| InChI | InChI=1S/C30H34N4Se2/c1-5-13-25(14-6-1)35-19-11-3-9-17-33-23-31-27-21-28-30(22-29(27)33)34(24-32-28)18-10-4-12-20-36-26-15-7-2-8-16-26/h1-2,5-8,13-16,21-24H,3-4,9-12,17-20H2 |
| InChIKey | RZUAGTQUVSQQII-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole?
The IUPAC name of 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole (CID 46862313) is 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole.
What is the SMILES notation for 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole?
The canonical SMILES for 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole is c1ccc([Se]CCCCCn2cnc3cc4ncn(CCCCC[Se]c5ccccc5)c4cc32)cc1.
What is the InChIKey of 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole?
The InChIKey is RZUAGTQUVSQQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H34N4Se2/c1-5-13-25(14-6-1)35-19-11-3-9-17-33-23-31-27-21-28-30(22-29(27)33)34(24-32-28)18-10-4-12-20-36-26-15-7-2-8-16-26/h1-2,5-8,13-16,21-24H,3-4,9-12,17-20H2.
What are the key properties of 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole?
1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole has a molecular weight of 608.55 g/mol, XLogP of 5.62, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-bis(5-phenylselanylpentyl)imidazo[4,5-f]benzimidazole is sourced from PubChem (CID 46862313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).