C22H28F2O4 — CID 46862771
(3aR,4R,5R,6aS)-4-(4,4-difluoro-3-oxooctyl)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 46862771) has the molecular formula C22H28F2O4 and a molecular weight of 394.46 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-(4,4-difluoro-3-oxooctyl)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-(4,4-difluoro-3-oxooctyl)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 46862771 |
| Molecular Formula | C22H28F2O4 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-(4,4-difluoro-3-oxooctyl)-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(F)(F)C(=O)CC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H28F2O4/c1-2-3-11-22(23,24)20(25)10-9-16-17-12-21(26)28-19(17)13-18(16)27-14-15-7-5-4-6-8-15/h4-8,16-19H,2-3,9-14H2,1H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | XEAHWTXINFDSJE-MKXGPGLRSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |