C22H28F2O4 — CID 46862772
(E)-1-[(3aR,4R,5R,6aS)-2-hydroxy-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4,4-difluorooct-1-en-3-one (PubChem CID 46862772) has the molecular formula C22H28F2O4 and a molecular weight of 394.46 g/mol. Its IUPAC name is (E)-1-[(3aR,4R,5R,6aS)-2-hydroxy-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4,4-difluorooct-1-en-3-one.
| Compound Name | (E)-1-[(3aR,4R,5R,6aS)-2-hydroxy-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4,4-difluorooct-1-en-3-one |
|---|---|
| PubChem CID | 46862772 |
| Molecular Formula | C22H28F2O4 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (E)-1-[(3aR,4R,5R,6aS)-2-hydroxy-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4,4-difluorooct-1-en-3-one |
| SMILES | CCCCC(F)(F)C(=O)/C=C/[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H28F2O4/c1-2-3-11-22(23,24)20(25)10-9-16-17-12-21(26)28-19(17)13-18(16)27-14-15-7-5-4-6-8-15/h4-10,16-19,21,26H,2-3,11-14H2,1H3/b10-9+/t16-,17-,18-,19+,21?/m1/s1 |
| InChIKey | MKONVEGDIWVMGQ-OEQFSCGKSA-N |
| XLogP | 4.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|