C34H44F2O5 — CID 46862879
benzyl (Z)-7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-phenylmethoxycyclopentyl]hept-5-enoate (PubChem CID 46862879) has the molecular formula C34H44F2O5 and a molecular weight of 570.72 g/mol. Its IUPAC name is benzyl (Z)-7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-phenylmethoxycyclopentyl]hept-5-enoate.
| Compound Name | benzyl (Z)-7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-phenylmethoxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 46862879 |
| Molecular Formula | C34H44F2O5 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | benzyl (Z)-7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-phenylmethoxycyclopentyl]hept-5-enoate |
| SMILES | CCCCC(F)(F)C(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)OCc2ccccc2)[C@@H](O)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H44F2O5/c1-2-3-22-34(35,36)32(38)21-20-29-28(30(37)23-31(29)40-24-26-14-8-6-9-15-26)18-12-4-5-13-19-33(39)41-25-27-16-10-7-11-17-27/h4,6-12,14-17,28-31,37H,2-3,5,13,18-25H2,1H3/b12-4-/t28-,29-,30+,31-/m1/s1 |
| InChIKey | AQEONSNBMXUIMK-MDFKSBHYSA-N |
| XLogP | 7.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|