C27H34F2O5 — CID 46862983
(Z)-7-[(1R,2R,3R)-2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxo-3-phenylmethoxycyclopentyl]hept-5-enoic acid (PubChem CID 46862983) has the molecular formula C27H34F2O5 and a molecular weight of 476.56 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxo-3-phenylmethoxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxo-3-phenylmethoxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 46862983 |
| Molecular Formula | C27H34F2O5 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxo-3-phenylmethoxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(F)(F)C(=O)/C=C/[C@H]1[C@H](OCc2ccccc2)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C27H34F2O5/c1-2-3-17-27(28,29)25(31)16-15-22-21(13-9-4-5-10-14-26(32)33)23(30)18-24(22)34-19-20-11-7-6-8-12-20/h4,6-9,11-12,15-16,21-22,24H,2-3,5,10,13-14,17-19H2,1H3,(H,32,33)/b9-4-,16-15+/t21-,22-,24-/m1/s1 |
| InChIKey | VHHUODFTHNZLIA-ZHZPUNHESA-N |
| XLogP | 5.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|