About [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate
[3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate (PubChem CID 46863030) has the molecular formula C22H33N5O3
and a molecular weight of 415.54 g/mol. Its IUPAC name is [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate.
Molecular Properties
| Compound Name | [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate |
| PubChem CID | 46863030 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate |
| SMILES | CN(Cc1cn(CC(O)COC(=O)NCc2ccccc2)nn1)CC1CCCCC1 |
| InChI | InChI=1S/C22H33N5O3/c1-26(13-19-10-6-3-7-11-19)14-20-15-27(25-24-20)16-21(28)17-30-22(29)23-12-18-8-4-2-5-9-18/h2,4-5,8-9,15,19,21,28H,3,6-7,10-14,16-17H2,1H3,(H,23,29) |
| InChIKey | KQWPTRUVHYRQJI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate?
The IUPAC name of [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate (CID 46863030) is [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate.
What is the SMILES notation for [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate?
The canonical SMILES for [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate is CN(Cc1cn(CC(O)COC(=O)NCc2ccccc2)nn1)CC1CCCCC1.
What is the InChIKey of [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate?
The InChIKey is KQWPTRUVHYRQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33N5O3/c1-26(13-19-10-6-3-7-11-19)14-20-15-27(25-24-20)16-21(28)17-30-22(29)23-12-18-8-4-2-5-9-18/h2,4-5,8-9,15,19,21,28H,3,6-7,10-14,16-17H2,1H3,(H,23,29).
What are the key properties of [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate?
[3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate has a molecular weight of 415.54 g/mol, XLogP of 2.58, 10 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-[[cyclohexylmethyl(methyl)amino]methyl]triazol-1-yl]-2-hydroxypropyl] N-benzylcarbamate is sourced from PubChem (CID 46863030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).