C22H26FN3OS — CID 46863039
2-[2-(1-adamantylimino)-3-methyl-1,3-thiazol-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 46863039) has the molecular formula C22H26FN3OS and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-methyl-1,3-thiazol-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-(1-adamantylimino)-3-methyl-1,3-thiazol-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 46863039 |
| Molecular Formula | C22H26FN3OS |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-methyl-1,3-thiazol-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | Cn1c(CC(=O)Nc2ccc(F)cc2)cs/c1=N\C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H26FN3OS/c1-26-19(9-20(27)24-18-4-2-17(23)3-5-18)13-28-21(26)25-22-10-14-6-15(11-22)8-16(7-14)12-22/h2-5,13-16H,6-12H2,1H3,(H,24,27)/b25-21- |
| InChIKey | BVWWEGWRSFLOMX-DAFNUICNSA-N |
| XLogP | 4.28 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|