About 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate
1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate (PubChem CID 46863122) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate |
| PubChem CID | 46863122 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](/C=C/C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C15H26O5/c1-7-19-14(18)13(17)11(10(2)3)8-9-12(16)20-15(4,5)6/h8-11,13,17H,7H2,1-6H3/b9-8+/t11-,13+/m0/s1 |
| InChIKey | FBNFCGSNQVKTBM-MDQMCFMNSA-N |
| XLogP | 2.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate?
The IUPAC name of 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate (CID 46863122) is 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate.
What is the SMILES notation for 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate?
The canonical SMILES for 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate is CCOC(=O)[C@H](O)[C@@H](/C=C/C(=O)OC(C)(C)C)C(C)C.
What is the InChIKey of 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate?
The InChIKey is FBNFCGSNQVKTBM-MDQMCFMNSA-N. The full InChI is InChI=1S/C15H26O5/c1-7-19-14(18)13(17)11(10(2)3)8-9-12(16)20-15(4,5)6/h8-11,13,17H,7H2,1-6H3/b9-8+/t11-,13+/m0/s1.
What are the key properties of 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate?
1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate has a molecular weight of 286.37 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 6-O-ethyl (E,4R,5R)-5-hydroxy-4-propan-2-ylhex-2-enedioate is sourced from PubChem (CID 46863122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).