About 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide
2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide (PubChem CID 46863281) has the molecular formula C15H21BrN2O2S
and a molecular weight of 373.32 g/mol. Its IUPAC name is 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide.
Molecular Properties
| Compound Name | 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide |
| PubChem CID | 46863281 |
| Molecular Formula | C15H21BrN2O2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide |
| SMILES | Br.Cn1c(C(=O)O)cs/c1=N\C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H20N2O2S.BrH/c1-17-12(13(18)19)8-20-14(17)16-15-5-9-2-10(6-15)4-11(3-9)7-15;/h8-11H,2-7H2,1H3,(H,18,19);1H/b16-14-; |
| InChIKey | KIMIPZRFICECHP-ULQCMBKMSA-N |
| XLogP | 3.23 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide?
The IUPAC name of 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide (CID 46863281) is 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide.
What is the SMILES notation for 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide?
The canonical SMILES for 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide is Br.Cn1c(C(=O)O)cs/c1=N\C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide?
The InChIKey is KIMIPZRFICECHP-ULQCMBKMSA-N. The full InChI is InChI=1S/C15H20N2O2S.BrH/c1-17-12(13(18)19)8-20-14(17)16-15-5-9-2-10(6-15)4-11(3-9)7-15;/h8-11H,2-7H2,1H3,(H,18,19);1H/b16-14-;.
What are the key properties of 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide?
2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide has a molecular weight of 373.32 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantylimino)-3-methyl-1,3-thiazole-4-carboxylic acid;hydrobromide is sourced from PubChem (CID 46863281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).