About 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide
2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide (PubChem CID 46863386) has the molecular formula C17H23BrN2O2S
and a molecular weight of 399.35 g/mol. Its IUPAC name is 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide.
Molecular Properties
| Compound Name | 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide |
| PubChem CID | 46863386 |
| Molecular Formula | C17H23BrN2O2S |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide |
| SMILES | Br.O=C(O)c1cs/c(=N\C23CC4CC(CC(C4)C2)C3)n1C1CC1 |
| InChI | InChI=1S/C17H22N2O2S.BrH/c20-15(21)14-9-22-16(19(14)13-1-2-13)18-17-6-10-3-11(7-17)5-12(4-10)8-17;/h9-13H,1-8H2,(H,20,21);1H/b18-16-; |
| InChIKey | YIPXCKNEVCHMRB-FTUZMNKQSA-N |
| XLogP | 4.03 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide?
The IUPAC name of 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide (CID 46863386) is 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide.
What is the SMILES notation for 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide?
The canonical SMILES for 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide is Br.O=C(O)c1cs/c(=N\C23CC4CC(CC(C4)C2)C3)n1C1CC1.
What is the InChIKey of 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide?
The InChIKey is YIPXCKNEVCHMRB-FTUZMNKQSA-N. The full InChI is InChI=1S/C17H22N2O2S.BrH/c20-15(21)14-9-22-16(19(14)13-1-2-13)18-17-6-10-3-11(7-17)5-12(4-10)8-17;/h9-13H,1-8H2,(H,20,21);1H/b18-16-;.
What are the key properties of 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide?
2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide has a molecular weight of 399.35 g/mol, XLogP of 4.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantylimino)-3-cyclopropyl-1,3-thiazole-4-carboxylic acid;hydrobromide is sourced from PubChem (CID 46863386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).