C15H22ClN2O3- — CID 46863837
N-[4-(2-hydroxy-3-pyrrolidin-1-ylpropoxy)phenyl]acetamide chloride (PubChem CID 46863837) has the molecular formula C15H22ClN2O3- and a molecular weight of 313.81 g/mol. Its IUPAC name is N-[4-(2-hydroxy-3-pyrrolidin-1-ylpropoxy)phenyl]acetamide chloride.
| Compound Name | N-[4-(2-hydroxy-3-pyrrolidin-1-ylpropoxy)phenyl]acetamide chloride |
|---|---|
| PubChem CID | 46863837 |
| Molecular Formula | C15H22ClN2O3- |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[4-(2-hydroxy-3-pyrrolidin-1-ylpropoxy)phenyl]acetamide chloride |
| SMILES | CC(=O)Nc1ccc(OCC(O)CN2CCCC2)cc1.[Cl-] |
| InChI | InChI=1S/C15H22N2O3.ClH/c1-12(18)16-13-4-6-15(7-5-13)20-11-14(19)10-17-8-2-3-9-17;/h4-7,14,19H,2-3,8-11H2,1H3,(H,16,18);1H/p-1 |
| InChIKey | GSUSSUVIBDEZGM-UHFFFAOYSA-M |
| XLogP | -1.52 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |