C36H36BF3O3STe — CID 46864184
[8-bis(2,4,6-trimethylphenyl)boranylnaphthalen-1-yl]-methyl-phenyltellanium;trifluoromethanesulfonate (PubChem CID 46864184) has the molecular formula C36H36BF3O3STe and a molecular weight of 744.15 g/mol. Its IUPAC name is [8-bis(2,4,6-trimethylphenyl)boranylnaphthalen-1-yl]-methyl-phenyltellanium;trifluoromethanesulfonate.
| Compound Name | [8-bis(2,4,6-trimethylphenyl)boranylnaphthalen-1-yl]-methyl-phenyltellanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 46864184 |
| Molecular Formula | C36H36BF3O3STe |
| Molecular Weight | 744.15 g/mol |
| Exact Mass | 746.15 |
| IUPAC Name | [8-bis(2,4,6-trimethylphenyl)boranylnaphthalen-1-yl]-methyl-phenyltellanium;trifluoromethanesulfonate |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c2cccc3cccc([Te+](C)c4ccccc4)c23)c(C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C35H36BTe.CHF3O3S/c1-23-19-25(3)34(26(4)20-23)36(35-27(5)21-24(2)22-28(35)6)31-17-11-13-29-14-12-18-32(33(29)31)37(7)30-15-9-8-10-16-30;2-1(3,4)8(5,6)7/h8-22H,1-7H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | STCUFUAPPSYMFT-UHFFFAOYSA-M |
| XLogP | 5.50 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.15 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|