C22H24N6OS — CID 46864478
4-[4-[[(10R)-9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]methyl]piperazin-1-yl]benzonitrile (PubChem CID 46864478) has the molecular formula C22H24N6OS and a molecular weight of 420.54 g/mol. Its IUPAC name is 4-[4-[[(10R)-9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]methyl]piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-[[(10R)-9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]methyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 46864478 |
| Molecular Formula | C22H24N6OS |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-[4-[[(10R)-9-oxo-12-thia-1,3,8-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-trien-5-yl]methyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN(Cc3cnc4c(c3)NC(=O)[C@@H]3CSCCN43)CC2)cc1 |
| InChI | InChI=1S/C22H24N6OS/c23-12-16-1-3-18(4-2-16)27-7-5-26(6-8-27)14-17-11-19-21(24-13-17)28-9-10-30-15-20(28)22(29)25-19/h1-4,11,13,20H,5-10,14-15H2,(H,25,29)/t20-/m0/s1 |
| InChIKey | MOKDCYQYOGLLTO-FQEVSTJZSA-N |
| XLogP | 2.15 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |