C21H17ClF3N5OS — CID 46864859
[3-chloro-6-(1,2,3,6-tetrahydropyridin-4-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-[3-(1,3-thiazol-2-yl)-2,5-dihydropyrrol-1-yl]methanone (PubChem CID 46864859) has the molecular formula C21H17ClF3N5OS and a molecular weight of 479.92 g/mol. Its IUPAC name is [3-chloro-6-(1,2,3,6-tetrahydropyridin-4-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-[3-(1,3-thiazol-2-yl)-2,5-dihydropyrrol-1-yl]methanone.
| Compound Name | [3-chloro-6-(1,2,3,6-tetrahydropyridin-4-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-[3-(1,3-thiazol-2-yl)-2,5-dihydropyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 46864859 |
| Molecular Formula | C21H17ClF3N5OS |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | [3-chloro-6-(1,2,3,6-tetrahydropyridin-4-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]-[3-(1,3-thiazol-2-yl)-2,5-dihydropyrrol-1-yl]methanone |
| SMILES | O=C(c1nc2c(C(F)(F)F)cc(C3=CCNCC3)cn2c1Cl)N1CC=C(c2nccs2)C1 |
| InChI | InChI=1S/C21H17ClF3N5OS/c22-17-16(20(31)29-7-3-13(10-29)19-27-6-8-32-19)28-18-15(21(23,24)25)9-14(11-30(17)18)12-1-4-26-5-2-12/h1,3,6,8-9,11,26H,2,4-5,7,10H2 |
| InChIKey | UXPJOAVHUBEBGP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |