C20H16ClF3N4O3 — CID 46864860
N-[1-[3-chloro-6-(furan-3-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbonyl]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 46864860) has the molecular formula C20H16ClF3N4O3 and a molecular weight of 452.82 g/mol. Its IUPAC name is N-[1-[3-chloro-6-(furan-3-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbonyl]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[1-[3-chloro-6-(furan-3-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbonyl]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 46864860 |
| Molecular Formula | C20H16ClF3N4O3 |
| Molecular Weight | 452.82 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-[1-[3-chloro-6-(furan-3-yl)-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carbonyl]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCN(C(=O)c2nc3c(C(F)(F)F)cc(-c4ccoc4)cn3c2Cl)C1 |
| InChI | InChI=1S/C20H16ClF3N4O3/c1-2-15(29)25-13-3-5-27(9-13)19(30)16-17(21)28-8-12(11-4-6-31-10-11)7-14(18(28)26-16)20(22,23)24/h2,4,6-8,10,13H,1,3,5,9H2,(H,25,29) |
| InChIKey | MSZFERRGAWKUBS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.82 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|