C30H41BN4O4 — CID 46865267
N-[1-(4-methylphenyl)-3-[[(1R)-3-methyl-1-[(2S,6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]pyrazine-2-carboxamide (PubChem CID 46865267) has the molecular formula C30H41BN4O4 and a molecular weight of 532.49 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)-3-[[(1R)-3-methyl-1-[(2S,6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]pyrazine-2-carboxamide.
| Compound Name | N-[1-(4-methylphenyl)-3-[[(1R)-3-methyl-1-[(2S,6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 46865267 |
| Molecular Formula | C30H41BN4O4 |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | N-[1-(4-methylphenyl)-3-[[(1R)-3-methyl-1-[(2S,6S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]pyrazine-2-carboxamide |
| SMILES | Cc1ccc(C(CC(=O)N[C@@H](CC(C)C)B2O[C@H]3C4CC(C[C@]3(C)O2)C4(C)C)NC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C30H41BN4O4/c1-18(2)13-25(31-38-27-22-14-21(29(22,4)5)16-30(27,6)39-31)35-26(36)15-23(20-9-7-19(3)8-10-20)34-28(37)24-17-32-11-12-33-24/h7-12,17-18,21-23,25,27H,13-16H2,1-6H3,(H,34,37)(H,35,36)/t21?,22?,23?,25-,27-,30-/m0/s1 |
| InChIKey | MUWSABJLRHYWBP-FDNZRYBFSA-N |
| XLogP | 4.44 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|