C33H43F3N6O2 — CID 46865621
2-N-[4-(1-benzylpiperidin-4-yl)oxy-3-(difluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 46865621) has the molecular formula C33H43F3N6O2 and a molecular weight of 612.74 g/mol. Its IUPAC name is 2-N-[4-(1-benzylpiperidin-4-yl)oxy-3-(difluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(1-benzylpiperidin-4-yl)oxy-3-(difluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 46865621 |
| Molecular Formula | C33H43F3N6O2 |
| Molecular Weight | 612.74 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | 2-N-[4-(1-benzylpiperidin-4-yl)oxy-3-(difluoromethoxy)phenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(OC4CCN(Cc5ccccc5)CC4)c(OC(F)F)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C33H43F3N6O2/c1-32(2)18-24(19-33(3,4)41(32)5)38-29-26(34)20-37-31(40-29)39-23-11-12-27(28(17-23)44-30(35)36)43-25-13-15-42(16-14-25)21-22-9-7-6-8-10-22/h6-12,17,20,24-25,30H,13-16,18-19,21H2,1-5H3,(H2,37,38,39,40) |
| InChIKey | MYDBITBKPFSCII-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.74 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |