C23H28O4 — CID 46865788
(5S,6R,7R,8S)-5-(3-(4-ethylbenzyl)-4-methylphenyl)-4-oxaspiro[2.5]octane-6,7,8-triol (PubChem CID 46865788) has the molecular formula C23H28O4 and a molecular weight of 368.50 g/mol. Its IUPAC name is (5S,6R,7R,8S)-5-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-4-oxaspiro[2.5]octane-6,7,8-triol.
| Compound Name | (5S,6R,7R,8S)-5-(3-(4-ethylbenzyl)-4-methylphenyl)-4-oxaspiro[2.5]octane-6,7,8-triol |
|---|---|
| PubChem CID | 46865788 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (5S,6R,7R,8S)-5-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-4-oxaspiro[2.5]octane-6,7,8-triol |
| SMILES | CCC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@H]3[C@@H]([C@H]([C@@H](C4(O3)CC4)O)O)O)C |
| InChI | InChI=1S/C23H28O4/c1-3-15-5-7-16(8-6-15)12-18-13-17(9-4-14(18)2)21-19(24)20(25)22(26)23(27-21)10-11-23/h4-9,13,19-22,24-26H,3,10-12H2,1-2H3/t19-,20-,21+,22+/m1/s1 |
| InChIKey | LVXRZEAKFCKSGM-CZYKHXBRSA-N |
| XLogP | 3.00 |
| TPSA | 69.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | 497 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |