C23H26ClFN2O2 — CID 46866440
8-chloro-1-(4-fluorophenyl)-6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-3,4-dihydroquinolin-2-one (PubChem CID 46866440) has the molecular formula C23H26ClFN2O2 and a molecular weight of 416.92 g/mol. Its IUPAC name is 8-chloro-1-(4-fluorophenyl)-6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-3,4-dihydroquinolin-2-one.
| Compound Name | 8-chloro-1-(4-fluorophenyl)-6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 46866440 |
| Molecular Formula | C23H26ClFN2O2 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 8-chloro-1-(4-fluorophenyl)-6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-3,4-dihydroquinolin-2-one |
| SMILES | C[C@@H]1CCCN1CCCOc1cc(Cl)c2c(c1)CCC(=O)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26ClFN2O2/c1-16-4-2-11-26(16)12-3-13-29-20-14-17-5-10-22(28)27(23(17)21(24)15-20)19-8-6-18(25)7-9-19/h6-9,14-16H,2-5,10-13H2,1H3/t16-/m1/s1 |
| InChIKey | FTSPEAYXJPPIRU-MRXNPFEDSA-N |
| XLogP | 5.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|