About 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline
2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 46866651) has the molecular formula C22H18N4O
and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline.
Molecular Properties
| Compound Name | 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| PubChem CID | 46866651 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | CC(C)Oc1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C22H18N4O/c1-13(2)27-15-9-7-14(8-10-15)22-25-20-16-5-3-11-23-18(16)19-17(21(20)26-22)6-4-12-24-19/h3-13H,1-2H3,(H,25,26) |
| InChIKey | OAMOZFLCWXZHHE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline?
The IUPAC name of 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline (CID 46866651) is 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline.
What is the SMILES notation for 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline?
The canonical SMILES for 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline is CC(C)Oc1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1.
What is the InChIKey of 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline?
The InChIKey is OAMOZFLCWXZHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O/c1-13(2)27-15-9-7-14(8-10-15)22-25-20-16-5-3-11-23-18(16)19-17(21(20)26-22)6-4-12-24-19/h3-13H,1-2H3,(H,25,26).
What are the key properties of 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline?
2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline has a molecular weight of 354.41 g/mol, XLogP of 5.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-propan-2-yloxyphenyl)-1H-imidazo[4,5-f][1,10]phenanthroline is sourced from PubChem (CID 46866651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).