C26H19ClN2O5 — CID 46866904
4-chloro-2-[[1,3-dioxo-2-(1,2,3,4-tetrahydronaphthalen-1-yl)isoindole-5-carbonyl]amino]benzoic acid (PubChem CID 46866904) has the molecular formula C26H19ClN2O5 and a molecular weight of 474.90 g/mol. Its IUPAC name is 4-chloro-2-[[1,3-dioxo-2-(1,2,3,4-tetrahydronaphthalen-1-yl)isoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[1,3-dioxo-2-(1,2,3,4-tetrahydronaphthalen-1-yl)isoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46866904 |
| Molecular Formula | C26H19ClN2O5 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4-chloro-2-[[1,3-dioxo-2-(1,2,3,4-tetrahydronaphthalen-1-yl)isoindole-5-carbonyl]amino]benzoic acid |
| SMILES | O=C(Nc1cc(Cl)ccc1C(=O)O)c1ccc2c(c1)C(=O)N(C1CCCc3ccccc31)C2=O |
| InChI | InChI=1S/C26H19ClN2O5/c27-16-9-11-19(26(33)34)21(13-16)28-23(30)15-8-10-18-20(12-15)25(32)29(24(18)31)22-7-3-5-14-4-1-2-6-17(14)22/h1-2,4,6,8-13,22H,3,5,7H2,(H,28,30)(H,33,34) |
| InChIKey | SMHZJQQYYVUSJR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|