C40H45NO11 — CID 46867005
3,4-bis(3,4-dimethoxyphenyl)-2-[(3,4,5-trimethoxyphenyl)methoxy]-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrole (PubChem CID 46867005) has the molecular formula C40H45NO11 and a molecular weight of 715.80 g/mol. Its IUPAC name is 3,4-bis(3,4-dimethoxyphenyl)-2-[(3,4,5-trimethoxyphenyl)methoxy]-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrole.
| Compound Name | 3,4-bis(3,4-dimethoxyphenyl)-2-[(3,4,5-trimethoxyphenyl)methoxy]-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrole |
|---|---|
| PubChem CID | 46867005 |
| Molecular Formula | C40H45NO11 |
| Molecular Weight | 715.80 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | 3,4-bis(3,4-dimethoxyphenyl)-2-[(3,4,5-trimethoxyphenyl)methoxy]-1-[(3,4,5-trimethoxyphenyl)methyl]pyrrole |
| SMILES | COc1ccc(-c2cn(Cc3cc(OC)c(OC)c(OC)c3)c(OCc3cc(OC)c(OC)c(OC)c3)c2-c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C40H45NO11/c1-42-29-13-11-26(19-31(29)44-3)28-22-41(21-24-15-33(46-5)38(50-9)34(16-24)47-6)40(37(28)27-12-14-30(43-2)32(20-27)45-4)52-23-25-17-35(48-7)39(51-10)36(18-25)49-8/h11-20,22H,21,23H2,1-10H3 |
| InChIKey | XCYJYOKWLZIVIB-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 106.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.80 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |