About 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid
4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid (PubChem CID 46867022) has the molecular formula C24H17ClN2O5
and a molecular weight of 448.86 g/mol. Its IUPAC name is 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid |
| PubChem CID | 46867022 |
| Molecular Formula | C24H17ClN2O5 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid |
| SMILES | O=C(Nc1cc(Cl)ccc1C(=O)O)c1ccc2c(c1)C(=O)N(CCc1ccccc1)C2=O |
| InChI | InChI=1S/C24H17ClN2O5/c25-16-7-9-18(24(31)32)20(13-16)26-21(28)15-6-8-17-19(12-15)23(30)27(22(17)29)11-10-14-4-2-1-3-5-14/h1-9,12-13H,10-11H2,(H,26,28)(H,31,32) |
| InChIKey | NPYAWSXQQNCZOF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_acid_B(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid?
The IUPAC name of 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid (CID 46867022) is 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid.
What is the SMILES notation for 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid?
The canonical SMILES for 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid is O=C(Nc1cc(Cl)ccc1C(=O)O)c1ccc2c(c1)C(=O)N(CCc1ccccc1)C2=O.
What is the InChIKey of 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid?
The InChIKey is NPYAWSXQQNCZOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17ClN2O5/c25-16-7-9-18(24(31)32)20(13-16)26-21(28)15-6-8-17-19(12-15)23(30)27(22(17)29)11-10-14-4-2-1-3-5-14/h1-9,12-13H,10-11H2,(H,26,28)(H,31,32).
What are the key properties of 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid?
4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid has a molecular weight of 448.86 g/mol, XLogP of 4.13, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[[1,3-dioxo-2-(2-phenylethyl)isoindole-5-carbonyl]amino]benzoic acid is sourced from PubChem (CID 46867022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).