C17H21N3O2 — CID 46867256
methyl 5-amino-2-methyl-6,7,8,9,10,11-hexahydrocycloocta[b][1,8]naphthyridine-3-carboxylate (PubChem CID 46867256) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl 5-amino-2-methyl-6,7,8,9,10,11-hexahydrocycloocta[b][1,8]naphthyridine-3-carboxylate.
| Compound Name | methyl 5-amino-2-methyl-6,7,8,9,10,11-hexahydrocycloocta[b][1,8]naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 46867256 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | methyl 5-amino-2-methyl-6,7,8,9,10,11-hexahydrocycloocta[b][1,8]naphthyridine-3-carboxylate |
| SMILES | COC(=O)c1cc2c(N)c3c(nc2nc1C)CCCCCC3 |
| InChI | InChI=1S/C17H21N3O2/c1-10-12(17(21)22-2)9-13-15(18)11-7-5-3-4-6-8-14(11)20-16(13)19-10/h9H,3-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | MJNRKJNEVQCSGU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |