C17H18N4O2S — CID 46867523
10-(benzenesulfonyl)-N,N-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-amine (PubChem CID 46867523) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 10-(benzenesulfonyl)-N,N-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-amine.
| Compound Name | 10-(benzenesulfonyl)-N,N-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-amine |
|---|---|
| PubChem CID | 46867523 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 10-(benzenesulfonyl)-N,N-dimethyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-11-amine |
| SMILES | CN(C)c1nn2c3c(cnc2c1S(=O)(=O)c1ccccc1)CCC3 |
| InChI | InChI=1S/C17H18N4O2S/c1-20(2)17-15(24(22,23)13-8-4-3-5-9-13)16-18-11-12-7-6-10-14(12)21(16)19-17/h3-5,8-9,11H,6-7,10H2,1-2H3 |
| InChIKey | HRRWSJGBBMAUIX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |