C20H21BrO3 — CID 46867888
(2S,3S,6S)-2-(bromomethyl)-3-[(3-methoxyphenyl)methoxy]-6-phenyl-3,6-dihydro-2H-pyran (PubChem CID 46867888) has the molecular formula C20H21BrO3 and a molecular weight of 389.29 g/mol. Its IUPAC name is (2S,3S,6S)-2-(bromomethyl)-3-[(3-methoxyphenyl)methoxy]-6-phenyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,3S,6S)-2-(bromomethyl)-3-[(3-methoxyphenyl)methoxy]-6-phenyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 46867888 |
| Molecular Formula | C20H21BrO3 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (2S,3S,6S)-2-(bromomethyl)-3-[(3-methoxyphenyl)methoxy]-6-phenyl-3,6-dihydro-2H-pyran |
| SMILES | COc1cccc(CO[C@H]2C=C[C@@H](c3ccccc3)O[C@@H]2CBr)c1 |
| InChI | InChI=1S/C20H21BrO3/c1-22-17-9-5-6-15(12-17)14-23-19-11-10-18(24-20(19)13-21)16-7-3-2-4-8-16/h2-12,18-20H,13-14H2,1H3/t18-,19-,20+/m0/s1 |
| InChIKey | IDANHJVNMORBOH-SLFFLAALSA-N |
| XLogP | 4.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|