C19H23Cl3FNO3 — CID 46868020
ethyl (2E,3R)-2-[(4-fluorophenyl)methylidene]-3-[(2,2,2-trichloroacetyl)amino]octanoate (PubChem CID 46868020) has the molecular formula C19H23Cl3FNO3 and a molecular weight of 438.75 g/mol. Its IUPAC name is ethyl (2E,3R)-2-[(4-fluorophenyl)methylidene]-3-[(2,2,2-trichloroacetyl)amino]octanoate.
| Compound Name | ethyl (2E,3R)-2-[(4-fluorophenyl)methylidene]-3-[(2,2,2-trichloroacetyl)amino]octanoate |
|---|---|
| PubChem CID | 46868020 |
| Molecular Formula | C19H23Cl3FNO3 |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | ethyl (2E,3R)-2-[(4-fluorophenyl)methylidene]-3-[(2,2,2-trichloroacetyl)amino]octanoate |
| SMILES | CCCCC[C@@H](NC(=O)C(Cl)(Cl)Cl)/C(=C\c1ccc(F)cc1)C(=O)OCC |
| InChI | InChI=1S/C19H23Cl3FNO3/c1-3-5-6-7-16(24-18(26)19(20,21)22)15(17(25)27-4-2)12-13-8-10-14(23)11-9-13/h8-12,16H,3-7H2,1-2H3,(H,24,26)/b15-12+/t16-/m1/s1 |
| InChIKey | KSGOPUYAYFNLKV-ASNKMWSDSA-N |
| XLogP | 5.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|