C14H21NO4 — CID 46868060
(1R,6R,8aS)-6-hydroxy-1-[(E,5R)-5-hydroxyhex-1-enyl]-8-methyl-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 46868060) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (1R,6R,8aS)-6-hydroxy-1-[(E,5R)-5-hydroxyhex-1-enyl]-8-methyl-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (1R,6R,8aS)-6-hydroxy-1-[(E,5R)-5-hydroxyhex-1-enyl]-8-methyl-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 46868060 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (1R,6R,8aS)-6-hydroxy-1-[(E,5R)-5-hydroxyhex-1-enyl]-8-methyl-1,5,6,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CC1=C[C@@H](O)CN2C(=O)O[C@H](/C=C/CC[C@@H](C)O)[C@H]12 |
| InChI | InChI=1S/C14H21NO4/c1-9-7-11(17)8-15-13(9)12(19-14(15)18)6-4-3-5-10(2)16/h4,6-7,10-13,16-17H,3,5,8H2,1-2H3/b6-4+/t10-,11-,12-,13+/m1/s1 |
| InChIKey | UHIQJXLTBHADDM-BQGVYOIKSA-N |
| XLogP | 1.21 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|