C15H17BrN6O2 — CID 46868351
5-bromo-3-nitro-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]pyridin-2-amine (PubChem CID 46868351) has the molecular formula C15H17BrN6O2 and a molecular weight of 393.25 g/mol. Its IUPAC name is 5-bromo-3-nitro-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]pyridin-2-amine.
| Compound Name | 5-bromo-3-nitro-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 46868351 |
| Molecular Formula | C15H17BrN6O2 |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 5-bromo-3-nitro-4-[4-(pyridin-4-ylmethyl)piperazin-1-yl]pyridin-2-amine |
| SMILES | Nc1ncc(Br)c(N2CCN(Cc3ccncc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17BrN6O2/c16-12-9-19-15(17)14(22(23)24)13(12)21-7-5-20(6-8-21)10-11-1-3-18-4-2-11/h1-4,9H,5-8,10H2,(H2,17,19) |
| InChIKey | IZCIHTGPVABHFF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|