C14H13NO5 — CID 46868411
2-[[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]methyl]benzoic acid (PubChem CID 46868411) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-[[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]methyl]benzoic acid.
| Compound Name | 2-[[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 46868411 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]methyl]benzoic acid |
| SMILES | CCOc1c(NCc2ccccc2C(=O)O)c(=O)c1=O |
| InChI | InChI=1S/C14H13NO5/c1-2-20-13-10(11(16)12(13)17)15-7-8-5-3-4-6-9(8)14(18)19/h3-6,15H,2,7H2,1H3,(H,18,19) |
| InChIKey | ADGDSMULOGPKGR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|