C10H8BN2 — CID 46868449
2,3-Dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine (PubChem CID 46868449) has the molecular formula C10H8BN2 and a molecular weight of 167.00 g/mol.
| Compound Name | 2,3-Dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine |
|---|---|
| PubChem CID | 46868449 |
| Molecular Formula | C10H8BN2 |
| Molecular Weight | 167.00 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | — |
| SMILES | [B]1Nc2cccc3cccc(c23)N1 |
| InChI | InChI=1S/C10H8BN2/c1-3-7-4-2-6-9-10(7)8(5-1)12-11-13-9/h1-6,12-13H |
| InChIKey | WFKIQDVBAUQIBH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.00 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|