C24H25BrN6 — CID 46868507
4-[6-bromo-7-(4-phenylpiperazin-1-yl)-1H-imidazo[4,5-b]pyridin-2-yl]-N,N-dimethylaniline (PubChem CID 46868507) has the molecular formula C24H25BrN6 and a molecular weight of 477.41 g/mol. Its IUPAC name is 4-[6-bromo-7-(4-phenylpiperazin-1-yl)-1H-imidazo[4,5-b]pyridin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[6-bromo-7-(4-phenylpiperazin-1-yl)-1H-imidazo[4,5-b]pyridin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 46868507 |
| Molecular Formula | C24H25BrN6 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 4-[6-bromo-7-(4-phenylpiperazin-1-yl)-1H-imidazo[4,5-b]pyridin-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc3ncc(Br)c(N4CCN(c5ccccc5)CC4)c3[nH]2)cc1 |
| InChI | InChI=1S/C24H25BrN6/c1-29(2)18-10-8-17(9-11-18)23-27-21-22(20(25)16-26-24(21)28-23)31-14-12-30(13-15-31)19-6-4-3-5-7-19/h3-11,16H,12-15H2,1-2H3,(H,26,27,28) |
| InChIKey | YRFSJKATAFOKCA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|