C26H22Cl3N3O3S — CID 46868603
4-[(4-chlorophenyl)methyl]-N-[(3,4-dichlorophenyl)methyl]-2,5-dioxo-1,3,6,7,8,9-hexahydro-[1]benzothiolo[2,3-e][1,4]diazepine-3-carboxamide (PubChem CID 46868603) has the molecular formula C26H22Cl3N3O3S and a molecular weight of 562.91 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N-[(3,4-dichlorophenyl)methyl]-2,5-dioxo-1,3,6,7,8,9-hexahydro-[1]benzothiolo[2,3-e][1,4]diazepine-3-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N-[(3,4-dichlorophenyl)methyl]-2,5-dioxo-1,3,6,7,8,9-hexahydro-[1]benzothiolo[2,3-e][1,4]diazepine-3-carboxamide |
|---|---|
| PubChem CID | 46868603 |
| Molecular Formula | C26H22Cl3N3O3S |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N-[(3,4-dichlorophenyl)methyl]-2,5-dioxo-1,3,6,7,8,9-hexahydro-[1]benzothiolo[2,3-e][1,4]diazepine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)c(Cl)c1)C1C(=O)Nc2sc3c(c2C(=O)N1Cc1ccc(Cl)cc1)CCCC3 |
| InChI | InChI=1S/C26H22Cl3N3O3S/c27-16-8-5-14(6-9-16)13-32-22(23(33)30-12-15-7-10-18(28)19(29)11-15)24(34)31-25-21(26(32)35)17-3-1-2-4-20(17)36-25/h5-11,22H,1-4,12-13H2,(H,30,33)(H,31,34) |
| InChIKey | SLQWAFGWPMEMTC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|