C24H26BrN7 — CID 46868649
4-[6-bromo-7-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-1H-imidazo[4,5-b]pyridin-2-yl]-N,N-dimethylaniline (PubChem CID 46868649) has the molecular formula C24H26BrN7 and a molecular weight of 492.43 g/mol. Its IUPAC name is 4-[6-bromo-7-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-1H-imidazo[4,5-b]pyridin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[6-bromo-7-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-1H-imidazo[4,5-b]pyridin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 46868649 |
| Molecular Formula | C24H26BrN7 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4-[6-bromo-7-[4-(pyridin-4-ylmethyl)piperazin-1-yl]-1H-imidazo[4,5-b]pyridin-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc3ncc(Br)c(N4CCN(Cc5ccncc5)CC4)c3[nH]2)cc1 |
| InChI | InChI=1S/C24H26BrN7/c1-30(2)19-5-3-18(4-6-19)23-28-21-22(20(25)15-27-24(21)29-23)32-13-11-31(12-14-32)16-17-7-9-26-10-8-17/h3-10,15H,11-14,16H2,1-2H3,(H,27,28,29) |
| InChIKey | MISIVIAMAATYRA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|