C9H12Cl3NO2 — CID 46868693
[(E)-4-prop-2-enoxybut-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 46868693) has the molecular formula C9H12Cl3NO2 and a molecular weight of 272.56 g/mol. Its IUPAC name is [(E)-4-prop-2-enoxybut-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-4-prop-2-enoxybut-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 46868693 |
| Molecular Formula | C9H12Cl3NO2 |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | [(E)-4-prop-2-enoxybut-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/COCC=C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H12Cl3NO2/c1-2-5-14-6-3-4-7-15-8(13)9(10,11)12/h2-4,13H,1,5-7H2/b4-3+,13-8- |
| InChIKey | HACJZTPHPIZYAM-ASIDLTKZSA-N |
| XLogP | 3.11 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|