About CID 46868736
CID 46868736 (PubChem CID 46868736) has the molecular formula C22H38O2Si
and a molecular weight of 362.63 g/mol.
Molecular Properties
| Compound Name | CID 46868736 |
| PubChem CID | 46868736 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](O/C=C1\C[C]=[C][C@H](O)[C@H]2CC(C)(C)C[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H38O2Si/c1-15(2)25(16(3)4,17(5)6)24-14-18-10-9-11-21(23)20-13-22(7,8)12-19(18)20/h14-17,19-21,23H,10,12-13H2,1-8H3/b18-14+/t19-,20-,21-/m0/s1 |
| InChIKey | OAHPMVSUIRXPPN-PNVRCKIDSA-N |
| XLogP | 6.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 46868736 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46868736?
The IUPAC name of CID 46868736 (CID 46868736) is not available.
What is the SMILES notation for CID 46868736?
The canonical SMILES for CID 46868736 is CC(C)[Si](O/C=C1\C[C]=[C][C@H](O)[C@H]2CC(C)(C)C[C@@H]12)(C(C)C)C(C)C.
What is the InChIKey of CID 46868736?
The InChIKey is OAHPMVSUIRXPPN-PNVRCKIDSA-N. The full InChI is InChI=1S/C22H38O2Si/c1-15(2)25(16(3)4,17(5)6)24-14-18-10-9-11-21(23)20-13-22(7,8)12-19(18)20/h14-17,19-21,23H,10,12-13H2,1-8H3/b18-14+/t19-,20-,21-/m0/s1.
What are the key properties of CID 46868736?
CID 46868736 has a molecular weight of 362.63 g/mol, XLogP of 6.04, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46868736 is sourced from PubChem (CID 46868736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).