C50H49N5O8S2 — CID 46869489
5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]-N-[2-(methyldisulfanyl)ethyl]pentanamide (PubChem CID 46869489) has the molecular formula C50H49N5O8S2 and a molecular weight of 912.10 g/mol. Its IUPAC name is 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]-N-[2-(methyldisulfanyl)ethyl]pentanamide.
| Compound Name | 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]-N-[2-(methyldisulfanyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 46869489 |
| Molecular Formula | C50H49N5O8S2 |
| Molecular Weight | 912.10 g/mol |
| Exact Mass | 911.30 |
| IUPAC Name | 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]-N-[2-(methyldisulfanyl)ethyl]pentanamide |
| SMILES | COc1cc2c(cc1OCc1cc(COc3cc4c(cc3OC)C(=O)N3c5ccccc5C[C@H]3C=N4)cc(OCCCCC(=O)NCCSSC)c1)N=C[C@@H]1Cc3ccccc3N1C2=O |
| InChI | InChI=1S/C50H49N5O8S2/c1-59-44-23-38-40(52-27-35-21-33-10-4-6-12-42(33)54(35)49(38)57)25-46(44)62-29-31-18-32(20-37(19-31)61-16-9-8-14-48(56)51-15-17-65-64-3)30-63-47-26-41-39(24-45(47)60-2)50(58)55-36(28-53-41)22-34-11-5-7-13-43(34)55/h4-7,10-13,18-20,23-28,35-36H,8-9,14-17,21-22,29-30H2,1-3H3,(H,51,56)/t35-,36-/m0/s1 |
| InChIKey | KKDSPNKHGSQBCQ-ZPGRZCPFSA-N |
| XLogP | 9.11 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.10 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|