C49H47N5O8S — CID 46869550
5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]-N-(2-sulfanylethyl)pentanamide (PubChem CID 46869550) has the molecular formula C49H47N5O8S and a molecular weight of 866.01 g/mol. Its IUPAC name is 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]-N-(2-sulfanylethyl)pentanamide.
| Compound Name | 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]-N-(2-sulfanylethyl)pentanamide |
|---|---|
| PubChem CID | 46869550 |
| Molecular Formula | C49H47N5O8S |
| Molecular Weight | 866.01 g/mol |
| Exact Mass | 865.31 |
| IUPAC Name | 5-[3,5-bis[[(12aS)-8-methoxy-6-oxo-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-9-yl]oxymethyl]phenoxy]-N-(2-sulfanylethyl)pentanamide |
| SMILES | COc1cc2c(cc1OCc1cc(COc3cc4c(cc3OC)C(=O)N3c5ccccc5C[C@H]3C=N4)cc(OCCCCC(=O)NCCS)c1)N=C[C@@H]1Cc3ccccc3N1C2=O |
| InChI | InChI=1S/C49H47N5O8S/c1-58-43-22-37-39(51-26-34-20-32-9-3-5-11-41(32)53(34)48(37)56)24-45(43)61-28-30-17-31(19-36(18-30)60-15-8-7-13-47(55)50-14-16-63)29-62-46-25-40-38(23-44(46)59-2)49(57)54-35(27-52-40)21-33-10-4-6-12-42(33)54/h3-6,9-12,17-19,22-27,34-35,63H,7-8,13-16,20-21,28-29H2,1-2H3,(H,50,55)/t34-,35-/m0/s1 |
| InChIKey | LRIQOIRZNBFWKT-PXLJZGITSA-N |
| XLogP | 8.03 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.01 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|