C21H20Cl2F3NO5S — CID 46870536
[8-[(3,4-dichlorophenyl)methyl]-7-(ethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 46870536) has the molecular formula C21H20Cl2F3NO5S and a molecular weight of 526.36 g/mol. Its IUPAC name is [8-[(3,4-dichlorophenyl)methyl]-7-(ethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-[(3,4-dichlorophenyl)methyl]-7-(ethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 46870536 |
| Molecular Formula | C21H20Cl2F3NO5S |
| Molecular Weight | 526.36 g/mol |
| Exact Mass | 525.04 |
| IUPAC Name | [8-[(3,4-dichlorophenyl)methyl]-7-(ethoxycarbonylamino)-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CCOC(=O)NC1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H20Cl2F3NO5S/c1-2-31-20(28)27-19-8-5-13-4-6-14(32-33(29,30)21(24,25)26)11-15(13)16(19)9-12-3-7-17(22)18(23)10-12/h3-4,6-7,10-11,16,19H,2,5,8-9H2,1H3,(H,27,28) |
| InChIKey | IYOXRIYLNPCVQS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|